8a80d8801a
* refactoring server for screens & page layout restructure * Disable API calls, UI placeholders. * buildPropsHierarchy is gone & screen has url * Recent changes. * router * router * updated git-ignore to reinclude server/utilities/builder * modified cli - budi new create new file structure * Fix uuid import. * prettier fixes * prettier fixes * prettier fixes * page/screen restructure.. broken tests * all tests passing at last * screen routing tests * Working screen editor and preview. * Render page previews to the screen. * Key input lists to ensure new array references when updating styles. * Ensure the iframe html and body fills the container. * Save screens via the API. * Get all save APIs almost working. * Write pages.json to disk. * Use correct API endpoint for saving styles. * Differentiate between saving properties of screens and pages. * Add required fields to default pages layouts. * Add _css default property to newly created screens. * Add default code property. * page layout / screens - app output Co-authored-by: pngwn <pnda007@gmail.com>
167 lines
3.2 KiB
JavaScript
167 lines
3.2 KiB
JavaScript
import svelte from "rollup-plugin-svelte"
|
|
import resolve from "rollup-plugin-node-resolve"
|
|
import commonjs from "rollup-plugin-commonjs"
|
|
import livereload from "rollup-plugin-livereload"
|
|
import { terser } from "rollup-plugin-terser"
|
|
import json from "rollup-plugin-json"
|
|
import alias from "rollup-plugin-alias"
|
|
import postcss from "rollup-plugin-postcss";
|
|
import path from "path"
|
|
|
|
const aliases = {
|
|
resolve: [".js", ".svelte"],
|
|
entries: [
|
|
// { find: "@BBMD", replacement: path.resolve(__dirname, "dist/index.js") },
|
|
{ find: "@BBMD", replacement: path.resolve(__dirname, "src/index.js") },
|
|
],
|
|
}
|
|
|
|
const postcssOptions = () => ({
|
|
extensions: [".scss", ".sass"],
|
|
extract: false,
|
|
minimize: true,
|
|
use: [
|
|
[
|
|
"sass",
|
|
{
|
|
includePaths: ["./node_modules"],
|
|
},
|
|
],
|
|
],
|
|
})
|
|
|
|
const production = !process.env.ROLLUP_WATCH
|
|
|
|
const lodash_fp_exports = [
|
|
"find",
|
|
"isUndefined",
|
|
"split",
|
|
"max",
|
|
"last",
|
|
"union",
|
|
"reduce",
|
|
"isObject",
|
|
"cloneDeep",
|
|
"some",
|
|
"isArray",
|
|
"map",
|
|
"filter",
|
|
"keys",
|
|
"isFunction",
|
|
"isEmpty",
|
|
"countBy",
|
|
"join",
|
|
"includes",
|
|
"flatten",
|
|
"constant",
|
|
"first",
|
|
"intersection",
|
|
"take",
|
|
"has",
|
|
"mapValues",
|
|
"isString",
|
|
"isBoolean",
|
|
"isNull",
|
|
"isNumber",
|
|
"isObjectLike",
|
|
"isDate",
|
|
"clone",
|
|
"values",
|
|
"keyBy",
|
|
"isNaN",
|
|
"isInteger",
|
|
"toNumber",
|
|
]
|
|
|
|
const lodash_exports = [
|
|
"flow",
|
|
"head",
|
|
"find",
|
|
"each",
|
|
"tail",
|
|
"findIndex",
|
|
"startsWith",
|
|
"dropRight",
|
|
"takeRight",
|
|
"trim",
|
|
"split",
|
|
"replace",
|
|
"merge",
|
|
"assign",
|
|
]
|
|
|
|
const coreExternal = [
|
|
"lodash",
|
|
"lodash/fp",
|
|
"date-fns",
|
|
"lunr",
|
|
"safe-buffer",
|
|
"shortid",
|
|
"@nx-js/compiler-util",
|
|
"bcryptjs",
|
|
]
|
|
|
|
export default {
|
|
input: "src/Test/testMain.js",
|
|
output: {
|
|
sourcemap: true,
|
|
format: "iife",
|
|
name: "app",
|
|
file: "public/build/bundle.js",
|
|
globals: {
|
|
crypto: "crypto",
|
|
},
|
|
},
|
|
plugins: [
|
|
alias(aliases),
|
|
svelte({
|
|
// enable run-time checks when not in production
|
|
dev: !production,
|
|
// we'll extract any component CSS out into
|
|
// a separate file — better for performance
|
|
css: css => {
|
|
css.write("public/build/bundle.css")
|
|
},
|
|
|
|
hydratable: true,
|
|
}),
|
|
|
|
// If you have external dependencies installed from
|
|
// npm, you'll most likely need these plugins. In
|
|
// some cases you'll need additional configuration —
|
|
// consult the documentation for details:
|
|
// https://github.com/rollup/rollup-plugin-commonjs
|
|
resolve({
|
|
browser: true,
|
|
dedupe: importee => {
|
|
return (
|
|
importee === "svelte" ||
|
|
importee.startsWith("svelte/") ||
|
|
coreExternal.includes(importee)
|
|
)
|
|
},
|
|
preferBuiltins: true,
|
|
}),
|
|
commonjs({
|
|
namedExports: {
|
|
"lodash/fp": lodash_fp_exports,
|
|
lodash: lodash_exports,
|
|
shortid: ["generate"],
|
|
},
|
|
}),
|
|
json(),
|
|
|
|
// Watch the `public` directory and refresh the
|
|
// browser on changes when not in production
|
|
!production && livereload("public"),
|
|
|
|
// If we're building for production (npm run build
|
|
// instead of npm run dev), minify
|
|
production && terser(),
|
|
postcss(postcssOptions()),
|
|
],
|
|
watch: {
|
|
clearScreen: false,
|
|
},
|
|
}
|